C14H26N4O2 — CID 82765009
[1-(2-amino-1-methylcyclopentanecarbonyl)piperidin-3-yl]methylurea (PubChem CID 82765009) has the molecular formula C14H26N4O2 and a molecular weight of 282.39 g/mol. Its IUPAC name is [1-(2-amino-1-methylcyclopentanecarbonyl)piperidin-3-yl]methylurea.
| Compound Name | [1-(2-amino-1-methylcyclopentanecarbonyl)piperidin-3-yl]methylurea |
|---|---|
| PubChem CID | 82765009 |
| Molecular Formula | C14H26N4O2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | [1-(2-amino-1-methylcyclopentanecarbonyl)piperidin-3-yl]methylurea |
| SMILES | CC1(C(=O)N2CCCC(CNC(N)=O)C2)CCCC1N |
| InChI | InChI=1S/C14H26N4O2/c1-14(6-2-5-11(14)15)12(19)18-7-3-4-10(9-18)8-17-13(16)20/h10-11H,2-9,15H2,1H3,(H3,16,17,20) |
| InChIKey | DZKRJTTWQYUKJZ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |