C12H11N3O6 — CID 82769905
3-(2-methyl-3,5-dioxopiperazin-1-yl)-4-nitrobenzoic acid (PubChem CID 82769905) has the molecular formula C12H11N3O6 and a molecular weight of 293.24 g/mol. Its IUPAC name is 3-(2-methyl-3,5-dioxopiperazin-1-yl)-4-nitrobenzoic acid.
| Compound Name | 3-(2-methyl-3,5-dioxopiperazin-1-yl)-4-nitrobenzoic acid |
|---|---|
| PubChem CID | 82769905 |
| Molecular Formula | C12H11N3O6 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 3-(2-methyl-3,5-dioxopiperazin-1-yl)-4-nitrobenzoic acid |
| SMILES | CC1C(=O)NC(=O)CN1c1cc(C(=O)O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H11N3O6/c1-6-11(17)13-10(16)5-14(6)9-4-7(12(18)19)2-3-8(9)15(20)21/h2-4,6H,5H2,1H3,(H,18,19)(H,13,16,17) |
| InChIKey | KTCHTBRMVGSCIL-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 129.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|