C9H19NO4 — CID 82770170
3-hydroxy-4-[2-hydroxyethyl(propan-2-yl)amino]butanoic acid (PubChem CID 82770170) has the molecular formula C9H19NO4 and a molecular weight of 205.25 g/mol. Its IUPAC name is 3-hydroxy-4-[2-hydroxyethyl(propan-2-yl)amino]butanoic acid.
| Compound Name | 3-hydroxy-4-[2-hydroxyethyl(propan-2-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 82770170 |
| Molecular Formula | C9H19NO4 |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 3-hydroxy-4-[2-hydroxyethyl(propan-2-yl)amino]butanoic acid |
| SMILES | CC(C)N(CCO)CC(O)CC(=O)O |
| InChI | InChI=1S/C9H19NO4/c1-7(2)10(3-4-11)6-8(12)5-9(13)14/h7-8,11-12H,3-6H2,1-2H3,(H,13,14) |
| InChIKey | VJQFXRRAGNOOIK-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |