C14H19FO2S — CID 82770394
3-(5-fluoro-2-methoxyphenyl)-4,4-dimethylthian-3-ol (PubChem CID 82770394) has the molecular formula C14H19FO2S and a molecular weight of 270.37 g/mol. Its IUPAC name is 3-(5-fluoro-2-methoxyphenyl)-4,4-dimethylthian-3-ol.
| Compound Name | 3-(5-fluoro-2-methoxyphenyl)-4,4-dimethylthian-3-ol |
|---|---|
| PubChem CID | 82770394 |
| Molecular Formula | C14H19FO2S |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 3-(5-fluoro-2-methoxyphenyl)-4,4-dimethylthian-3-ol |
| SMILES | COc1ccc(F)cc1C1(O)CSCCC1(C)C |
| InChI | InChI=1S/C14H19FO2S/c1-13(2)6-7-18-9-14(13,16)11-8-10(15)4-5-12(11)17-3/h4-5,8,16H,6-7,9H2,1-3H3 |
| InChIKey | QQPFYPAZUMSFGZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |