C13H25NO3 — CID 82770626
ethyl 4-(2,3-dimethylpiperidin-1-yl)-3-hydroxybutanoate (PubChem CID 82770626) has the molecular formula C13H25NO3 and a molecular weight of 243.35 g/mol. Its IUPAC name is ethyl 4-(2,3-dimethylpiperidin-1-yl)-3-hydroxybutanoate.
| Compound Name | ethyl 4-(2,3-dimethylpiperidin-1-yl)-3-hydroxybutanoate |
|---|---|
| PubChem CID | 82770626 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | ethyl 4-(2,3-dimethylpiperidin-1-yl)-3-hydroxybutanoate |
| SMILES | CCOC(=O)CC(O)CN1CCCC(C)C1C |
| InChI | InChI=1S/C13H25NO3/c1-4-17-13(16)8-12(15)9-14-7-5-6-10(2)11(14)3/h10-12,15H,4-9H2,1-3H3 |
| InChIKey | NRRIMCUTGGCQJA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |