C14H17ClF2N2O2 — CID 82771776
(4-chloro-2,5-difluorophenyl)-[2-[(dimethylamino)methyl]-4-hydroxypyrrolidin-1-yl]methanone (PubChem CID 82771776) has the molecular formula C14H17ClF2N2O2 and a molecular weight of 318.75 g/mol. Its IUPAC name is (4-chloro-2,5-difluorophenyl)-[2-[(dimethylamino)methyl]-4-hydroxypyrrolidin-1-yl]methanone.
| Compound Name | (4-chloro-2,5-difluorophenyl)-[2-[(dimethylamino)methyl]-4-hydroxypyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 82771776 |
| Molecular Formula | C14H17ClF2N2O2 |
| Molecular Weight | 318.75 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | (4-chloro-2,5-difluorophenyl)-[2-[(dimethylamino)methyl]-4-hydroxypyrrolidin-1-yl]methanone |
| SMILES | CN(C)CC1CC(O)CN1C(=O)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C14H17ClF2N2O2/c1-18(2)6-8-3-9(20)7-19(8)14(21)10-4-13(17)11(15)5-12(10)16/h4-5,8-9,20H,3,6-7H2,1-2H3 |
| InChIKey | KQWYSQKAXLQWTJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.75 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|