C16H13ClF2O2 — CID 82771936
(4-chloro-2,5-difluorophenyl)-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methanol (PubChem CID 82771936) has the molecular formula C16H13ClF2O2 and a molecular weight of 310.73 g/mol. Its IUPAC name is (4-chloro-2,5-difluorophenyl)-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methanol.
| Compound Name | (4-chloro-2,5-difluorophenyl)-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methanol |
|---|---|
| PubChem CID | 82771936 |
| Molecular Formula | C16H13ClF2O2 |
| Molecular Weight | 310.73 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | (4-chloro-2,5-difluorophenyl)-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methanol |
| SMILES | CC1Cc2cc(C(O)c3cc(F)c(Cl)cc3F)ccc2O1 |
| InChI | InChI=1S/C16H13ClF2O2/c1-8-4-10-5-9(2-3-15(10)21-8)16(20)11-6-14(19)12(17)7-13(11)18/h2-3,5-8,16,20H,4H2,1H3 |
| InChIKey | ZSJAHTBDEXHBRP-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.73 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|