C17H15ClF2O — CID 82772598
(4-butan-2-ylphenyl)-(4-chloro-2,5-difluorophenyl)methanone (PubChem CID 82772598) has the molecular formula C17H15ClF2O and a molecular weight of 308.76 g/mol. Its IUPAC name is (4-butan-2-ylphenyl)-(4-chloro-2,5-difluorophenyl)methanone.
| Compound Name | (4-butan-2-ylphenyl)-(4-chloro-2,5-difluorophenyl)methanone |
|---|---|
| PubChem CID | 82772598 |
| Molecular Formula | C17H15ClF2O |
| Molecular Weight | 308.76 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | (4-butan-2-ylphenyl)-(4-chloro-2,5-difluorophenyl)methanone |
| SMILES | CCC(C)c1ccc(C(=O)c2cc(F)c(Cl)cc2F)cc1 |
| InChI | InChI=1S/C17H15ClF2O/c1-3-10(2)11-4-6-12(7-5-11)17(21)13-8-16(20)14(18)9-15(13)19/h4-10H,3H2,1-2H3 |
| InChIKey | ARFVPHCQXUZDJP-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.76 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|