C16H13ClF2O2 — CID 82772715
(4-chloro-2,5-difluorophenyl)-(4-propan-2-yloxyphenyl)methanone (PubChem CID 82772715) has the molecular formula C16H13ClF2O2 and a molecular weight of 310.73 g/mol. Its IUPAC name is (4-chloro-2,5-difluorophenyl)-(4-propan-2-yloxyphenyl)methanone.
| Compound Name | (4-chloro-2,5-difluorophenyl)-(4-propan-2-yloxyphenyl)methanone |
|---|---|
| PubChem CID | 82772715 |
| Molecular Formula | C16H13ClF2O2 |
| Molecular Weight | 310.73 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | (4-chloro-2,5-difluorophenyl)-(4-propan-2-yloxyphenyl)methanone |
| SMILES | CC(C)Oc1ccc(C(=O)c2cc(F)c(Cl)cc2F)cc1 |
| InChI | InChI=1S/C16H13ClF2O2/c1-9(2)21-11-5-3-10(4-6-11)16(20)12-7-15(19)13(17)8-14(12)18/h3-9H,1-2H3 |
| InChIKey | NINJTNHKBNKPLQ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.73 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|