C14H8ClF2N3O — CID 82772621
3-(4-chloro-2,5-difluorophenyl)-4-pyridin-4-yl-1,2-oxazol-5-amine (PubChem CID 82772621) has the molecular formula C14H8ClF2N3O and a molecular weight of 307.69 g/mol. Its IUPAC name is 3-(4-chloro-2,5-difluorophenyl)-4-pyridin-4-yl-1,2-oxazol-5-amine.
| Compound Name | 3-(4-chloro-2,5-difluorophenyl)-4-pyridin-4-yl-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 82772621 |
| Molecular Formula | C14H8ClF2N3O |
| Molecular Weight | 307.69 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 3-(4-chloro-2,5-difluorophenyl)-4-pyridin-4-yl-1,2-oxazol-5-amine |
| SMILES | Nc1onc(-c2cc(F)c(Cl)cc2F)c1-c1ccncc1 |
| InChI | InChI=1S/C14H8ClF2N3O/c15-9-6-10(16)8(5-11(9)17)13-12(14(18)21-20-13)7-1-3-19-4-2-7/h1-6H,18H2 |
| InChIKey | DJYNSHXFUQMILK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.69 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|