About 2-(4-chloro-2,5-difluorophenyl)-5,6-difluoro-1H-benzimidazole
2-(4-chloro-2,5-difluorophenyl)-5,6-difluoro-1H-benzimidazole (PubChem CID 82772918) has the molecular formula C13H5ClF4N2
and a molecular weight of 300.64 g/mol. Its IUPAC name is 2-(4-chloro-2,5-difluorophenyl)-5,6-difluoro-1H-benzimidazole.
Molecular Properties
| Compound Name | 2-(4-chloro-2,5-difluorophenyl)-5,6-difluoro-1H-benzimidazole |
| PubChem CID | 82772918 |
| Molecular Formula | C13H5ClF4N2 |
| Molecular Weight | 300.64 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | 2-(4-chloro-2,5-difluorophenyl)-5,6-difluoro-1H-benzimidazole |
| SMILES | Fc1cc2nc(-c3cc(F)c(Cl)cc3F)[nH]c2cc1F |
| InChI | InChI=1S/C13H5ClF4N2/c14-6-2-7(15)5(1-8(6)16)13-19-11-3-9(17)10(18)4-12(11)20-13/h1-4H,(H,19,20) |
| InChIKey | UXXVSUPSJBKHSA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.64 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chloro-2,5-difluorophenyl)-5,6-difluoro-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chloro-2,5-difluorophenyl)-5,6-difluoro-1H-benzimidazole?
The IUPAC name of 2-(4-chloro-2,5-difluorophenyl)-5,6-difluoro-1H-benzimidazole (CID 82772918) is 2-(4-chloro-2,5-difluorophenyl)-5,6-difluoro-1H-benzimidazole.
What is the SMILES notation for 2-(4-chloro-2,5-difluorophenyl)-5,6-difluoro-1H-benzimidazole?
The canonical SMILES for 2-(4-chloro-2,5-difluorophenyl)-5,6-difluoro-1H-benzimidazole is Fc1cc2nc(-c3cc(F)c(Cl)cc3F)[nH]c2cc1F.
What is the InChIKey of 2-(4-chloro-2,5-difluorophenyl)-5,6-difluoro-1H-benzimidazole?
The InChIKey is UXXVSUPSJBKHSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H5ClF4N2/c14-6-2-7(15)5(1-8(6)16)13-19-11-3-9(17)10(18)4-12(11)20-13/h1-4H,(H,19,20).
What are the key properties of 2-(4-chloro-2,5-difluorophenyl)-5,6-difluoro-1H-benzimidazole?
2-(4-chloro-2,5-difluorophenyl)-5,6-difluoro-1H-benzimidazole has a molecular weight of 300.64 g/mol, XLogP of 4.44, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloro-2,5-difluorophenyl)-5,6-difluoro-1H-benzimidazole is sourced from PubChem (CID 82772918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).