C14H10ClF2N3 — CID 82774776
[2-(4-chloro-2,5-difluorophenyl)-3H-benzimidazol-5-yl]methanamine (PubChem CID 82774776) has the molecular formula C14H10ClF2N3 and a molecular weight of 293.70 g/mol. Its IUPAC name is [2-(4-chloro-2,5-difluorophenyl)-3H-benzimidazol-5-yl]methanamine.
| Compound Name | [2-(4-chloro-2,5-difluorophenyl)-3H-benzimidazol-5-yl]methanamine |
|---|---|
| PubChem CID | 82774776 |
| Molecular Formula | C14H10ClF2N3 |
| Molecular Weight | 293.70 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | [2-(4-chloro-2,5-difluorophenyl)-3H-benzimidazol-5-yl]methanamine |
| SMILES | NCc1ccc2nc(-c3cc(F)c(Cl)cc3F)[nH]c2c1 |
| InChI | InChI=1S/C14H10ClF2N3/c15-9-5-10(16)8(4-11(9)17)14-19-12-2-1-7(6-18)3-13(12)20-14/h1-5H,6,18H2,(H,19,20) |
| InChIKey | XHUPVWJUDLNHGM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.70 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|