C14H11Cl2N3 — CID 79004447
[2-(3,5-dichlorophenyl)-3H-benzimidazol-5-yl]methanamine (PubChem CID 79004447) has the molecular formula C14H11Cl2N3 and a molecular weight of 292.17 g/mol. Its IUPAC name is [2-(3,5-dichlorophenyl)-3H-benzimidazol-5-yl]methanamine.
| Compound Name | [2-(3,5-dichlorophenyl)-3H-benzimidazol-5-yl]methanamine |
|---|---|
| PubChem CID | 79004447 |
| Molecular Formula | C14H11Cl2N3 |
| Molecular Weight | 292.17 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | [2-(3,5-dichlorophenyl)-3H-benzimidazol-5-yl]methanamine |
| SMILES | NCc1ccc2nc(-c3cc(Cl)cc(Cl)c3)[nH]c2c1 |
| InChI | InChI=1S/C14H11Cl2N3/c15-10-4-9(5-11(16)6-10)14-18-12-2-1-8(7-17)3-13(12)19-14/h1-6H,7,17H2,(H,18,19) |
| InChIKey | BXRKDVXOCRSEJU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.17 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |