C14H19ClF2N2O — CID 82773249
N-(3-amino-2,2-dimethylpropyl)-4-chloro-N-ethyl-2,5-difluorobenzamide (PubChem CID 82773249) has the molecular formula C14H19ClF2N2O and a molecular weight of 304.77 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-4-chloro-N-ethyl-2,5-difluorobenzamide.
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-4-chloro-N-ethyl-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 82773249 |
| Molecular Formula | C14H19ClF2N2O |
| Molecular Weight | 304.77 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-4-chloro-N-ethyl-2,5-difluorobenzamide |
| SMILES | CCN(CC(C)(C)CN)C(=O)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C14H19ClF2N2O/c1-4-19(8-14(2,3)7-18)13(20)9-5-12(17)10(15)6-11(9)16/h5-6H,4,7-8,18H2,1-3H3 |
| InChIKey | ITLRACVYWXEVGO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.77 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|