C16H26BrClN2O — CID 82775218
2-[[3-(4-bromo-2-chlorophenyl)-3-(ethylamino)propyl]-propylamino]ethanol (PubChem CID 82775218) has the molecular formula C16H26BrClN2O and a molecular weight of 377.75 g/mol. Its IUPAC name is 2-[[3-(4-bromo-2-chlorophenyl)-3-(ethylamino)propyl]-propylamino]ethanol.
| Compound Name | 2-[[3-(4-bromo-2-chlorophenyl)-3-(ethylamino)propyl]-propylamino]ethanol |
|---|---|
| PubChem CID | 82775218 |
| Molecular Formula | C16H26BrClN2O |
| Molecular Weight | 377.75 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 2-[[3-(4-bromo-2-chlorophenyl)-3-(ethylamino)propyl]-propylamino]ethanol |
| SMILES | CCCN(CCO)CCC(NCC)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C16H26BrClN2O/c1-3-8-20(10-11-21)9-7-16(19-4-2)14-6-5-13(17)12-15(14)18/h5-6,12,16,19,21H,3-4,7-11H2,1-2H3 |
| InChIKey | GIAYJAFDWGVAKL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.75 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |