C17H24BrClN2 — CID 82775892
1-(4-bromo-2-chlorophenyl)-N-ethyl-N',N'-bis(prop-2-enyl)propane-1,3-diamine (PubChem CID 82775892) has the molecular formula C17H24BrClN2 and a molecular weight of 371.75 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)-N-ethyl-N',N'-bis(prop-2-enyl)propane-1,3-diamine.
| Compound Name | 1-(4-bromo-2-chlorophenyl)-N-ethyl-N',N'-bis(prop-2-enyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 82775892 |
| Molecular Formula | C17H24BrClN2 |
| Molecular Weight | 371.75 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)-N-ethyl-N',N'-bis(prop-2-enyl)propane-1,3-diamine |
| SMILES | C=CCN(CC=C)CCC(NCC)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C17H24BrClN2/c1-4-10-21(11-5-2)12-9-17(20-6-3)15-8-7-14(18)13-16(15)19/h4-5,7-8,13,17,20H,1-2,6,9-12H2,3H3 |
| InChIKey | VQJVJLLXCKOWTQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.75 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|