C8H10N2O5 — CID 82775280
4-(3,6-dioxo-1H-pyridazin-2-yl)-3-hydroxybutanoic acid (PubChem CID 82775280) has the molecular formula C8H10N2O5 and a molecular weight of 214.18 g/mol. Its IUPAC name is 4-(3,6-dioxo-1H-pyridazin-2-yl)-3-hydroxybutanoic acid.
| Compound Name | 4-(3,6-dioxo-1H-pyridazin-2-yl)-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 82775280 |
| Molecular Formula | C8H10N2O5 |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 4-(3,6-dioxo-1H-pyridazin-2-yl)-3-hydroxybutanoic acid |
| SMILES | O=C(O)CC(O)Cn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C8H10N2O5/c11-5(3-8(14)15)4-10-7(13)2-1-6(12)9-10/h1-2,5,11H,3-4H2,(H,9,12)(H,14,15) |
| InChIKey | KJIJGSUOBVXBHB-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 112.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |