C10H14N2O5 — CID 82775496
ethyl 4-(3,6-dioxo-1H-pyridazin-2-yl)-3-hydroxybutanoate (PubChem CID 82775496) has the molecular formula C10H14N2O5 and a molecular weight of 242.23 g/mol. Its IUPAC name is ethyl 4-(3,6-dioxo-1H-pyridazin-2-yl)-3-hydroxybutanoate.
| Compound Name | ethyl 4-(3,6-dioxo-1H-pyridazin-2-yl)-3-hydroxybutanoate |
|---|---|
| PubChem CID | 82775496 |
| Molecular Formula | C10H14N2O5 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | ethyl 4-(3,6-dioxo-1H-pyridazin-2-yl)-3-hydroxybutanoate |
| SMILES | CCOC(=O)CC(O)Cn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C10H14N2O5/c1-2-17-10(16)5-7(13)6-12-9(15)4-3-8(14)11-12/h3-4,7,13H,2,5-6H2,1H3,(H,11,14) |
| InChIKey | OARJWMJVXGXQTF-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |