C16H15BrClNO2 — CID 82775621
2-[1-(4-bromo-2-chlorophenyl)ethylamino]-2-phenylacetic acid (PubChem CID 82775621) has the molecular formula C16H15BrClNO2 and a molecular weight of 368.66 g/mol. Its IUPAC name is 2-[1-(4-bromo-2-chlorophenyl)ethylamino]-2-phenylacetic acid.
| Compound Name | 2-[1-(4-bromo-2-chlorophenyl)ethylamino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 82775621 |
| Molecular Formula | C16H15BrClNO2 |
| Molecular Weight | 368.66 g/mol |
| Exact Mass | 367.00 |
| IUPAC Name | 2-[1-(4-bromo-2-chlorophenyl)ethylamino]-2-phenylacetic acid |
| SMILES | CC(NC(C(=O)O)c1ccccc1)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C16H15BrClNO2/c1-10(13-8-7-12(17)9-14(13)18)19-15(16(20)21)11-5-3-2-4-6-11/h2-10,15,19H,1H3,(H,20,21) |
| InChIKey | XNULTZFKGNYAEF-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.66 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |