C11H18N2O4 — CID 82776514
ethyl 4-(3-ethyl-2-oxoimidazol-1-yl)-3-hydroxybutanoate (PubChem CID 82776514) has the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. Its IUPAC name is ethyl 4-(3-ethyl-2-oxoimidazol-1-yl)-3-hydroxybutanoate.
| Compound Name | ethyl 4-(3-ethyl-2-oxoimidazol-1-yl)-3-hydroxybutanoate |
|---|---|
| PubChem CID | 82776514 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | ethyl 4-(3-ethyl-2-oxoimidazol-1-yl)-3-hydroxybutanoate |
| SMILES | CCOC(=O)CC(O)Cn1ccn(CC)c1=O |
| InChI | InChI=1S/C11H18N2O4/c1-3-12-5-6-13(11(12)16)8-9(14)7-10(15)17-4-2/h5-6,9,14H,3-4,7-8H2,1-2H3 |
| InChIKey | UYURAPARAYJONU-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 73.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |