C12H20N2O5 — CID 82778065
ethyl 4-(4-ethyl-2,5-dioxopiperazin-1-yl)-3-hydroxybutanoate (PubChem CID 82778065) has the molecular formula C12H20N2O5 and a molecular weight of 272.30 g/mol. Its IUPAC name is ethyl 4-(4-ethyl-2,5-dioxopiperazin-1-yl)-3-hydroxybutanoate.
| Compound Name | ethyl 4-(4-ethyl-2,5-dioxopiperazin-1-yl)-3-hydroxybutanoate |
|---|---|
| PubChem CID | 82778065 |
| Molecular Formula | C12H20N2O5 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | ethyl 4-(4-ethyl-2,5-dioxopiperazin-1-yl)-3-hydroxybutanoate |
| SMILES | CCOC(=O)CC(O)CN1CC(=O)N(CC)CC1=O |
| InChI | InChI=1S/C12H20N2O5/c1-3-13-7-11(17)14(8-10(13)16)6-9(15)5-12(18)19-4-2/h9,15H,3-8H2,1-2H3 |
| InChIKey | KMIXCWCTBFHPCT-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |