C8H7BrClNO2S — CID 82779692
(E)-2-(4-bromo-2-chlorophenyl)ethenesulfonamide (PubChem CID 82779692) has the molecular formula C8H7BrClNO2S and a molecular weight of 296.57 g/mol. Its IUPAC name is (E)-2-(4-bromo-2-chlorophenyl)ethenesulfonamide.
| Compound Name | (E)-2-(4-bromo-2-chlorophenyl)ethenesulfonamide |
|---|---|
| PubChem CID | 82779692 |
| Molecular Formula | C8H7BrClNO2S |
| Molecular Weight | 296.57 g/mol |
| Exact Mass | 294.91 |
| IUPAC Name | (E)-2-(4-bromo-2-chlorophenyl)ethenesulfonamide |
| SMILES | NS(=O)(=O)/C=C/c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C8H7BrClNO2S/c9-7-2-1-6(8(10)5-7)3-4-14(11,12)13/h1-5H,(H2,11,12,13)/b4-3+ |
| InChIKey | YXRMDEXLVQIOTI-ONEGZZNKSA-N |
| XLogP | 2.36 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.57 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |