C17H15BrClNO3S — CID 15603087
4-bromo-2-chloro-N-[(E)-2-(2,4-dimethylphenyl)ethenyl]sulfonylbenzamide (PubChem CID 15603087) has the molecular formula C17H15BrClNO3S and a molecular weight of 428.74 g/mol. Its IUPAC name is 4-bromo-2-chloro-N-[(E)-2-(2,4-dimethylphenyl)ethenyl]sulfonylbenzamide.
| Compound Name | 4-bromo-2-chloro-N-[(E)-2-(2,4-dimethylphenyl)ethenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 15603087 |
| Molecular Formula | C17H15BrClNO3S |
| Molecular Weight | 428.74 g/mol |
| Exact Mass | 426.96 |
| IUPAC Name | 4-bromo-2-chloro-N-[(E)-2-(2,4-dimethylphenyl)ethenyl]sulfonylbenzamide |
| SMILES | Cc1ccc(/C=C/S(=O)(=O)NC(=O)c2ccc(Br)cc2Cl)c(C)c1 |
| InChI | InChI=1S/C17H15BrClNO3S/c1-11-3-4-13(12(2)9-11)7-8-24(22,23)20-17(21)15-6-5-14(18)10-16(15)19/h3-10H,1-2H3,(H,20,21)/b8-7+ |
| InChIKey | UWRVDHOQHJOJTF-BQYQJAHWSA-N |
| XLogP | 4.45 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.74 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |