C19H21NO3S — CID 69431995
N-[2-(2,4-dimethylphenyl)ethenylsulfonyl]-2,4-dimethylbenzamide (PubChem CID 69431995) has the molecular formula C19H21NO3S and a molecular weight of 343.45 g/mol. Its IUPAC name is N-[2-(2,4-dimethylphenyl)ethenylsulfonyl]-2,4-dimethylbenzamide.
| Compound Name | N-[2-(2,4-dimethylphenyl)ethenylsulfonyl]-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 69431995 |
| Molecular Formula | C19H21NO3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | N-[2-(2,4-dimethylphenyl)ethenylsulfonyl]-2,4-dimethylbenzamide |
| SMILES | Cc1ccc(C=CS(=O)(=O)NC(=O)c2ccc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C19H21NO3S/c1-13-5-7-17(15(3)11-13)9-10-24(22,23)20-19(21)18-8-6-14(2)12-16(18)4/h5-12H,1-4H3,(H,20,21) |
| InChIKey | XLCQBXGQFNSTRO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |