C12H8BrN3O2S — CID 82784629
3-[(4-bromothiophen-2-yl)methyl]benzotriazole-5-carboxylic acid (PubChem CID 82784629) has the molecular formula C12H8BrN3O2S and a molecular weight of 338.19 g/mol. Its IUPAC name is 3-[(4-bromothiophen-2-yl)methyl]benzotriazole-5-carboxylic acid.
| Compound Name | 3-[(4-bromothiophen-2-yl)methyl]benzotriazole-5-carboxylic acid |
|---|---|
| PubChem CID | 82784629 |
| Molecular Formula | C12H8BrN3O2S |
| Molecular Weight | 338.19 g/mol |
| Exact Mass | 336.95 |
| IUPAC Name | 3-[(4-bromothiophen-2-yl)methyl]benzotriazole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2nnn(Cc3cc(Br)cs3)c2c1 |
| InChI | InChI=1S/C12H8BrN3O2S/c13-8-4-9(19-6-8)5-16-11-3-7(12(17)18)1-2-10(11)14-15-16/h1-4,6H,5H2,(H,17,18) |
| InChIKey | CWLDSTKJCHDHPW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.19 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |