C16H21BrN2O2 — CID 82785130
4-[2-(2-bromo-4-cyanoanilino)ethyl]-5-methylhexanoic acid (PubChem CID 82785130) has the molecular formula C16H21BrN2O2 and a molecular weight of 353.26 g/mol. Its IUPAC name is 4-[2-(2-bromo-4-cyanoanilino)ethyl]-5-methylhexanoic acid.
| Compound Name | 4-[2-(2-bromo-4-cyanoanilino)ethyl]-5-methylhexanoic acid |
|---|---|
| PubChem CID | 82785130 |
| Molecular Formula | C16H21BrN2O2 |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 4-[2-(2-bromo-4-cyanoanilino)ethyl]-5-methylhexanoic acid |
| SMILES | CC(C)C(CCNc1ccc(C#N)cc1Br)CCC(=O)O |
| InChI | InChI=1S/C16H21BrN2O2/c1-11(2)13(4-6-16(20)21)7-8-19-15-5-3-12(10-18)9-14(15)17/h3,5,9,11,13,19H,4,6-8H2,1-2H3,(H,20,21) |
| InChIKey | IWHBJZFJWMEWOW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |