C16H21ClFN3 — CID 82787681
1-(3-chloro-2-fluorophenyl)-3-(3-ethyl-1-methylpyrazol-5-yl)-N-methylpropan-2-amine (PubChem CID 82787681) has the molecular formula C16H21ClFN3 and a molecular weight of 309.82 g/mol. Its IUPAC name is 1-(3-chloro-2-fluorophenyl)-3-(3-ethyl-1-methylpyrazol-5-yl)-N-methylpropan-2-amine.
| Compound Name | 1-(3-chloro-2-fluorophenyl)-3-(3-ethyl-1-methylpyrazol-5-yl)-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 82787681 |
| Molecular Formula | C16H21ClFN3 |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 1-(3-chloro-2-fluorophenyl)-3-(3-ethyl-1-methylpyrazol-5-yl)-N-methylpropan-2-amine |
| SMILES | CCc1cc(CC(Cc2cccc(Cl)c2F)NC)n(C)n1 |
| InChI | InChI=1S/C16H21ClFN3/c1-4-12-9-14(21(3)20-12)10-13(19-2)8-11-6-5-7-15(17)16(11)18/h5-7,9,13,19H,4,8,10H2,1-3H3 |
| InChIKey | CAIDHSKKJYKYRL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |