C10H13F3N2O — CID 82788708
6-methyl-2-(4,4,4-trifluorobutoxy)pyridin-3-amine (PubChem CID 82788708) has the molecular formula C10H13F3N2O and a molecular weight of 234.22 g/mol. Its IUPAC name is 6-methyl-2-(4,4,4-trifluorobutoxy)pyridin-3-amine.
| Compound Name | 6-methyl-2-(4,4,4-trifluorobutoxy)pyridin-3-amine |
|---|---|
| PubChem CID | 82788708 |
| Molecular Formula | C10H13F3N2O |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 6-methyl-2-(4,4,4-trifluorobutoxy)pyridin-3-amine |
| SMILES | Cc1ccc(N)c(OCCCC(F)(F)F)n1 |
| InChI | InChI=1S/C10H13F3N2O/c1-7-3-4-8(14)9(15-7)16-6-2-5-10(11,12)13/h3-4H,2,5-6,14H2,1H3 |
| InChIKey | CRDMOTVDLJWBNA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|