C10H15F3N2O2 — CID 82788775
N-(2-cyanoethyl)-N-methyl-2-(4,4,4-trifluorobutoxy)acetamide (PubChem CID 82788775) has the molecular formula C10H15F3N2O2 and a molecular weight of 252.24 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N-methyl-2-(4,4,4-trifluorobutoxy)acetamide.
| Compound Name | N-(2-cyanoethyl)-N-methyl-2-(4,4,4-trifluorobutoxy)acetamide |
|---|---|
| PubChem CID | 82788775 |
| Molecular Formula | C10H15F3N2O2 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | N-(2-cyanoethyl)-N-methyl-2-(4,4,4-trifluorobutoxy)acetamide |
| SMILES | CN(CCC#N)C(=O)COCCCC(F)(F)F |
| InChI | InChI=1S/C10H15F3N2O2/c1-15(6-3-5-14)9(16)8-17-7-2-4-10(11,12)13/h2-4,6-8H2,1H3 |
| InChIKey | GEJPHPDWJMGJGP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|