C14H19ClF3NO — CID 82790108
1-[3-chloro-4-(4,4,4-trifluorobutoxy)phenyl]-N-ethylethanamine (PubChem CID 82790108) has the molecular formula C14H19ClF3NO and a molecular weight of 309.76 g/mol. Its IUPAC name is 1-[3-chloro-4-(4,4,4-trifluorobutoxy)phenyl]-N-ethylethanamine.
| Compound Name | 1-[3-chloro-4-(4,4,4-trifluorobutoxy)phenyl]-N-ethylethanamine |
|---|---|
| PubChem CID | 82790108 |
| Molecular Formula | C14H19ClF3NO |
| Molecular Weight | 309.76 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 1-[3-chloro-4-(4,4,4-trifluorobutoxy)phenyl]-N-ethylethanamine |
| SMILES | CCNC(C)c1ccc(OCCCC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C14H19ClF3NO/c1-3-19-10(2)11-5-6-13(12(15)9-11)20-8-4-7-14(16,17)18/h5-6,9-10,19H,3-4,7-8H2,1-2H3 |
| InChIKey | NFULJEFBIBKOKW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.76 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|