C11H15F3N2O3 — CID 82791894
2-methyl-5-(4,4,4-trifluorobutoxymethyl)furan-3-carbohydrazide (PubChem CID 82791894) has the molecular formula C11H15F3N2O3 and a molecular weight of 280.25 g/mol. Its IUPAC name is 2-methyl-5-(4,4,4-trifluorobutoxymethyl)furan-3-carbohydrazide.
| Compound Name | 2-methyl-5-(4,4,4-trifluorobutoxymethyl)furan-3-carbohydrazide |
|---|---|
| PubChem CID | 82791894 |
| Molecular Formula | C11H15F3N2O3 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 2-methyl-5-(4,4,4-trifluorobutoxymethyl)furan-3-carbohydrazide |
| SMILES | Cc1oc(COCCCC(F)(F)F)cc1C(=O)NN |
| InChI | InChI=1S/C11H15F3N2O3/c1-7-9(10(17)16-15)5-8(19-7)6-18-4-2-3-11(12,13)14/h5H,2-4,6,15H2,1H3,(H,16,17) |
| InChIKey | FPEDBRZMOLAFES-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|