About 5-ethyl-3,5-dimethyl-1,3-oxazolidine-2,4-dione
5-ethyl-3,5-dimethyl-1,3-oxazolidine-2,4-dione (PubChem CID 8280) has the molecular formula C7H11NO3
and a molecular weight of 157.17 g/mol. Its IUPAC name is 5-ethyl-3,5-dimethyl-1,3-oxazolidine-2,4-dione.
Analyze 5-ethyl-3,5-dimethyl-1,3-oxazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-3,5-dimethyl-1,3-oxazolidine-2,4-dione?
The IUPAC name of 5-ethyl-3,5-dimethyl-1,3-oxazolidine-2,4-dione (CID 8280) is 5-ethyl-3,5-dimethyl-1,3-oxazolidine-2,4-dione.
What is the SMILES notation for 5-ethyl-3,5-dimethyl-1,3-oxazolidine-2,4-dione?
The canonical SMILES for 5-ethyl-3,5-dimethyl-1,3-oxazolidine-2,4-dione is CCC1(C)OC(=O)N(C)C1=O.
What is the InChIKey of 5-ethyl-3,5-dimethyl-1,3-oxazolidine-2,4-dione?
The InChIKey is VQASKUSHBVDKGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3/c1-4-7(2)5(9)8(3)6(10)11-7/h4H2,1-3H3.
What are the key properties of 5-ethyl-3,5-dimethyl-1,3-oxazolidine-2,4-dione?
5-ethyl-3,5-dimethyl-1,3-oxazolidine-2,4-dione has a molecular weight of 157.17 g/mol, XLogP of 0.76, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-3,5-dimethyl-1,3-oxazolidine-2,4-dione is sourced from PubChem (CID 8280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).