C13H20BrN3 — CID 82800268
3-bromo-4-[2,2-dimethylpropyl(methyl)amino]benzenecarboximidamide (PubChem CID 82800268) has the molecular formula C13H20BrN3 and a molecular weight of 298.23 g/mol. Its IUPAC name is 3-bromo-4-[2,2-dimethylpropyl(methyl)amino]benzenecarboximidamide.
| Compound Name | 3-bromo-4-[2,2-dimethylpropyl(methyl)amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 82800268 |
| Molecular Formula | C13H20BrN3 |
| Molecular Weight | 298.23 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 3-bromo-4-[2,2-dimethylpropyl(methyl)amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N(C)CC(C)(C)C)c(Br)c1 |
| InChI | InChI=1S/C13H20BrN3/c1-13(2,3)8-17(4)11-6-5-9(12(15)16)7-10(11)14/h5-7H,8H2,1-4H3,(H3,15,16) |
| InChIKey | SORJUZRHPOBIQV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.23 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|