C11H12BrF3N2S — CID 82804762
3-bromo-4-[methyl(3,3,3-trifluoropropyl)amino]benzenecarbothioamide (PubChem CID 82804762) has the molecular formula C11H12BrF3N2S and a molecular weight of 341.20 g/mol. Its IUPAC name is 3-bromo-4-[methyl(3,3,3-trifluoropropyl)amino]benzenecarbothioamide.
| Compound Name | 3-bromo-4-[methyl(3,3,3-trifluoropropyl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 82804762 |
| Molecular Formula | C11H12BrF3N2S |
| Molecular Weight | 341.20 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | 3-bromo-4-[methyl(3,3,3-trifluoropropyl)amino]benzenecarbothioamide |
| SMILES | CN(CCC(F)(F)F)c1ccc(C(N)=S)cc1Br |
| InChI | InChI=1S/C11H12BrF3N2S/c1-17(5-4-11(13,14)15)9-3-2-7(10(16)18)6-8(9)12/h2-3,6H,4-5H2,1H3,(H2,16,18) |
| InChIKey | GBFAQMAVYSLBSK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.20 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|