C10H12F3N3S — CID 114288619
3-[methyl(3,3,3-trifluoropropyl)amino]pyridine-4-carbothioamide (PubChem CID 114288619) has the molecular formula C10H12F3N3S and a molecular weight of 263.29 g/mol. Its IUPAC name is 3-[methyl(3,3,3-trifluoropropyl)amino]pyridine-4-carbothioamide.
| Compound Name | 3-[methyl(3,3,3-trifluoropropyl)amino]pyridine-4-carbothioamide |
|---|---|
| PubChem CID | 114288619 |
| Molecular Formula | C10H12F3N3S |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 3-[methyl(3,3,3-trifluoropropyl)amino]pyridine-4-carbothioamide |
| SMILES | CN(CCC(F)(F)F)c1cnccc1C(N)=S |
| InChI | InChI=1S/C10H12F3N3S/c1-16(5-3-10(11,12)13)8-6-15-4-2-7(8)9(14)17/h2,4,6H,3,5H2,1H3,(H2,14,17) |
| InChIKey | NOBGUGOCTWSHDH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|