C15H17ClFN3 — CID 82805536
N-[[2-[(3-chloro-2-fluorophenyl)methyl]pyrimidin-4-yl]methyl]propan-1-amine (PubChem CID 82805536) has the molecular formula C15H17ClFN3 and a molecular weight of 293.77 g/mol. Its IUPAC name is N-[[2-[(3-chloro-2-fluorophenyl)methyl]pyrimidin-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-[(3-chloro-2-fluorophenyl)methyl]pyrimidin-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 82805536 |
| Molecular Formula | C15H17ClFN3 |
| Molecular Weight | 293.77 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | N-[[2-[(3-chloro-2-fluorophenyl)methyl]pyrimidin-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccnc(Cc2cccc(Cl)c2F)n1 |
| InChI | InChI=1S/C15H17ClFN3/c1-2-7-18-10-12-6-8-19-14(20-12)9-11-4-3-5-13(16)15(11)17/h3-6,8,18H,2,7,9-10H2,1H3 |
| InChIKey | AAWRWFIDSOWNKH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.77 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|