C18H26BrNO — CID 82807158
3-[(3-bromophenyl)methoxy]-N-methylspiro[3.6]decan-1-amine (PubChem CID 82807158) has the molecular formula C18H26BrNO and a molecular weight of 352.32 g/mol. Its IUPAC name is 3-[(3-bromophenyl)methoxy]-N-methylspiro[3.6]decan-1-amine.
| Compound Name | 3-[(3-bromophenyl)methoxy]-N-methylspiro[3.6]decan-1-amine |
|---|---|
| PubChem CID | 82807158 |
| Molecular Formula | C18H26BrNO |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 3-[(3-bromophenyl)methoxy]-N-methylspiro[3.6]decan-1-amine |
| SMILES | CNC1CC(OCc2cccc(Br)c2)C12CCCCCC2 |
| InChI | InChI=1S/C18H26BrNO/c1-20-16-12-17(18(16)9-4-2-3-5-10-18)21-13-14-7-6-8-15(19)11-14/h6-8,11,16-17,20H,2-5,9-10,12-13H2,1H3 |
| InChIKey | SXIZCAJTBVBDMD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |