C15H17ClFNOS — CID 82808604
3-amino-2-(3-chloro-2-fluorophenyl)-1-(3-ethylthiophen-2-yl)propan-1-ol (PubChem CID 82808604) has the molecular formula C15H17ClFNOS and a molecular weight of 313.83 g/mol. Its IUPAC name is 3-amino-2-(3-chloro-2-fluorophenyl)-1-(3-ethylthiophen-2-yl)propan-1-ol.
| Compound Name | 3-amino-2-(3-chloro-2-fluorophenyl)-1-(3-ethylthiophen-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 82808604 |
| Molecular Formula | C15H17ClFNOS |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 3-amino-2-(3-chloro-2-fluorophenyl)-1-(3-ethylthiophen-2-yl)propan-1-ol |
| SMILES | CCc1ccsc1C(O)C(CN)c1cccc(Cl)c1F |
| InChI | InChI=1S/C15H17ClFNOS/c1-2-9-6-7-20-15(9)14(19)11(8-18)10-4-3-5-12(16)13(10)17/h3-7,11,14,19H,2,8,18H2,1H3 |
| InChIKey | PIKPAIHIXIUBRC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |