C13H13F3N2OS — CID 82810692
N-[[5-(methylsulfanylmethyl)furan-2-yl]methyl]-6-(trifluoromethyl)pyridin-3-amine (PubChem CID 82810692) has the molecular formula C13H13F3N2OS and a molecular weight of 302.32 g/mol. Its IUPAC name is N-[[5-(methylsulfanylmethyl)furan-2-yl]methyl]-6-(trifluoromethyl)pyridin-3-amine.
| Compound Name | N-[[5-(methylsulfanylmethyl)furan-2-yl]methyl]-6-(trifluoromethyl)pyridin-3-amine |
|---|---|
| PubChem CID | 82810692 |
| Molecular Formula | C13H13F3N2OS |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | N-[[5-(methylsulfanylmethyl)furan-2-yl]methyl]-6-(trifluoromethyl)pyridin-3-amine |
| SMILES | CSCc1ccc(CNc2ccc(C(F)(F)F)nc2)o1 |
| InChI | InChI=1S/C13H13F3N2OS/c1-20-8-11-4-3-10(19-11)7-17-9-2-5-12(18-6-9)13(14,15)16/h2-6,17H,7-8H2,1H3 |
| InChIKey | UUZJAAABJUXEPK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |