C15H17F3N2S — CID 82794611
N-[(5-tert-butylthiophen-2-yl)methyl]-6-(trifluoromethyl)pyridin-3-amine (PubChem CID 82794611) has the molecular formula C15H17F3N2S and a molecular weight of 314.38 g/mol. Its IUPAC name is N-[(5-tert-butylthiophen-2-yl)methyl]-6-(trifluoromethyl)pyridin-3-amine.
| Compound Name | N-[(5-tert-butylthiophen-2-yl)methyl]-6-(trifluoromethyl)pyridin-3-amine |
|---|---|
| PubChem CID | 82794611 |
| Molecular Formula | C15H17F3N2S |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | N-[(5-tert-butylthiophen-2-yl)methyl]-6-(trifluoromethyl)pyridin-3-amine |
| SMILES | CC(C)(C)c1ccc(CNc2ccc(C(F)(F)F)nc2)s1 |
| InChI | InChI=1S/C15H17F3N2S/c1-14(2,3)13-7-5-11(21-13)9-19-10-4-6-12(20-8-10)15(16,17)18/h4-8,19H,9H2,1-3H3 |
| InChIKey | FYSZBZKRUPMAHJ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |