C16H24FNO — CID 82811219
1-[2-(2-fluoro-3-methoxyphenyl)cycloheptyl]-N-methylmethanamine (PubChem CID 82811219) has the molecular formula C16H24FNO and a molecular weight of 265.37 g/mol. Its IUPAC name is 1-[2-(2-fluoro-3-methoxyphenyl)cycloheptyl]-N-methylmethanamine.
| Compound Name | 1-[2-(2-fluoro-3-methoxyphenyl)cycloheptyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 82811219 |
| Molecular Formula | C16H24FNO |
| Molecular Weight | 265.37 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 1-[2-(2-fluoro-3-methoxyphenyl)cycloheptyl]-N-methylmethanamine |
| SMILES | CNCC1CCCCCC1c1cccc(OC)c1F |
| InChI | InChI=1S/C16H24FNO/c1-18-11-12-7-4-3-5-8-13(12)14-9-6-10-15(19-2)16(14)17/h6,9-10,12-13,18H,3-5,7-8,11H2,1-2H3 |
| InChIKey | KNKVTCDDXGQROA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |