C13H22N2O6 — CID 82812995
(2S)-2-(2-acetamidopropanoylamino)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid (PubChem CID 82812995) has the molecular formula C13H22N2O6 and a molecular weight of 302.33 g/mol. Its IUPAC name is (2S)-2-(2-acetamidopropanoylamino)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid.
| Compound Name | (2S)-2-(2-acetamidopropanoylamino)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 82812995 |
| Molecular Formula | C13H22N2O6 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (2S)-2-(2-acetamidopropanoylamino)-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
| SMILES | CC(=O)NC(C)C(=O)N[C@@H](CC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C13H22N2O6/c1-7(14-8(2)16)11(18)15-9(12(19)20)6-10(17)21-13(3,4)5/h7,9H,6H2,1-5H3,(H,14,16)(H,15,18)(H,19,20)/t7?,9-/m0/s1 |
| InChIKey | AIYWMFHMHKJOFB-NETXQHHPSA-N |
| XLogP | -0.19 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |