About 2-[(2-hydroxy-2,4-dimethylpentyl)amino]-3-nitropyridine-4-carbonitrile
2-[(2-hydroxy-2,4-dimethylpentyl)amino]-3-nitropyridine-4-carbonitrile (PubChem CID 82813746) has the molecular formula C13H18N4O3
and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-[(2-hydroxy-2,4-dimethylpentyl)amino]-3-nitropyridine-4-carbonitrile.
Molecular Properties
| Compound Name | 2-[(2-hydroxy-2,4-dimethylpentyl)amino]-3-nitropyridine-4-carbonitrile |
| PubChem CID | 82813746 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 2-[(2-hydroxy-2,4-dimethylpentyl)amino]-3-nitropyridine-4-carbonitrile |
| SMILES | CC(C)CC(C)(O)CNc1nccc(C#N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H18N4O3/c1-9(2)6-13(3,18)8-16-12-11(17(19)20)10(7-14)4-5-15-12/h4-5,9,18H,6,8H2,1-3H3,(H,15,16) |
| InChIKey | NYQZCCKRFZRFIP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 112.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-hydroxy-2,4-dimethylpentyl)amino]-3-nitropyridine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-hydroxy-2,4-dimethylpentyl)amino]-3-nitropyridine-4-carbonitrile?
The IUPAC name of 2-[(2-hydroxy-2,4-dimethylpentyl)amino]-3-nitropyridine-4-carbonitrile (CID 82813746) is 2-[(2-hydroxy-2,4-dimethylpentyl)amino]-3-nitropyridine-4-carbonitrile.
What is the SMILES notation for 2-[(2-hydroxy-2,4-dimethylpentyl)amino]-3-nitropyridine-4-carbonitrile?
The canonical SMILES for 2-[(2-hydroxy-2,4-dimethylpentyl)amino]-3-nitropyridine-4-carbonitrile is CC(C)CC(C)(O)CNc1nccc(C#N)c1[N+](=O)[O-].
What is the InChIKey of 2-[(2-hydroxy-2,4-dimethylpentyl)amino]-3-nitropyridine-4-carbonitrile?
The InChIKey is NYQZCCKRFZRFIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O3/c1-9(2)6-13(3,18)8-16-12-11(17(19)20)10(7-14)4-5-15-12/h4-5,9,18H,6,8H2,1-3H3,(H,15,16).
What are the key properties of 2-[(2-hydroxy-2,4-dimethylpentyl)amino]-3-nitropyridine-4-carbonitrile?
2-[(2-hydroxy-2,4-dimethylpentyl)amino]-3-nitropyridine-4-carbonitrile has a molecular weight of 278.31 g/mol, XLogP of 2.07, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-hydroxy-2,4-dimethylpentyl)amino]-3-nitropyridine-4-carbonitrile is sourced from PubChem (CID 82813746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).