C14H16ClF2NO2 — CID 82815850
[2-(chloromethyl)-5-methylmorpholin-4-yl]-(2,6-difluoro-3-methylphenyl)methanone (PubChem CID 82815850) has the molecular formula C14H16ClF2NO2 and a molecular weight of 303.74 g/mol. Its IUPAC name is [2-(chloromethyl)-5-methylmorpholin-4-yl]-(2,6-difluoro-3-methylphenyl)methanone.
| Compound Name | [2-(chloromethyl)-5-methylmorpholin-4-yl]-(2,6-difluoro-3-methylphenyl)methanone |
|---|---|
| PubChem CID | 82815850 |
| Molecular Formula | C14H16ClF2NO2 |
| Molecular Weight | 303.74 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | [2-(chloromethyl)-5-methylmorpholin-4-yl]-(2,6-difluoro-3-methylphenyl)methanone |
| SMILES | Cc1ccc(F)c(C(=O)N2CC(CCl)OCC2C)c1F |
| InChI | InChI=1S/C14H16ClF2NO2/c1-8-3-4-11(16)12(13(8)17)14(19)18-6-10(5-15)20-7-9(18)2/h3-4,9-10H,5-7H2,1-2H3 |
| InChIKey | PHGHTGIBKFUTPD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.74 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|