C13H14BrClFNO2 — CID 81211638
(3-bromo-5-fluorophenyl)-[2-(chloromethyl)-5-methylmorpholin-4-yl]methanone (PubChem CID 81211638) has the molecular formula C13H14BrClFNO2 and a molecular weight of 350.62 g/mol. Its IUPAC name is (3-bromo-5-fluorophenyl)-[2-(chloromethyl)-5-methylmorpholin-4-yl]methanone.
| Compound Name | (3-bromo-5-fluorophenyl)-[2-(chloromethyl)-5-methylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 81211638 |
| Molecular Formula | C13H14BrClFNO2 |
| Molecular Weight | 350.62 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | (3-bromo-5-fluorophenyl)-[2-(chloromethyl)-5-methylmorpholin-4-yl]methanone |
| SMILES | CC1COC(CCl)CN1C(=O)c1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C13H14BrClFNO2/c1-8-7-19-12(5-15)6-17(8)13(18)9-2-10(14)4-11(16)3-9/h2-4,8,12H,5-7H2,1H3 |
| InChIKey | VDAICBPYDONHKE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.62 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|