C17H23N3O — CID 82823571
4-[3-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)phenoxy]butanenitrile (PubChem CID 82823571) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 4-[3-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)phenoxy]butanenitrile.
| Compound Name | 4-[3-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)phenoxy]butanenitrile |
|---|---|
| PubChem CID | 82823571 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 4-[3-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)phenoxy]butanenitrile |
| SMILES | N#CCCCOc1cccc(NC2CCN3CCCC23)c1 |
| InChI | InChI=1S/C17H23N3O/c18-9-1-2-12-21-15-6-3-5-14(13-15)19-16-8-11-20-10-4-7-17(16)20/h3,5-6,13,16-17,19H,1-2,4,7-8,10-12H2 |
| InChIKey | RALPMHWGMPOLFZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|