C16H20N2O2 — CID 62065096
4-[3-(3,4-dihydro-2H-pyran-2-ylmethylamino)phenoxy]butanenitrile (PubChem CID 62065096) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 4-[3-(3,4-dihydro-2H-pyran-2-ylmethylamino)phenoxy]butanenitrile.
| Compound Name | 4-[3-(3,4-dihydro-2H-pyran-2-ylmethylamino)phenoxy]butanenitrile |
|---|---|
| PubChem CID | 62065096 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 4-[3-(3,4-dihydro-2H-pyran-2-ylmethylamino)phenoxy]butanenitrile |
| SMILES | N#CCCCOc1cccc(NCC2CCC=CO2)c1 |
| InChI | InChI=1S/C16H20N2O2/c17-9-2-4-11-19-15-8-5-6-14(12-15)18-13-16-7-1-3-10-20-16/h3,5-6,8,10,12,16,18H,1-2,4,7,11,13H2 |
| InChIKey | JJVZQXSSMNSRME-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|