C15H20BrNO2 — CID 82824680
(2-bromophenyl)methyl 3-ethylpiperidine-3-carboxylate (PubChem CID 82824680) has the molecular formula C15H20BrNO2 and a molecular weight of 326.23 g/mol. Its IUPAC name is (2-bromophenyl)methyl 3-ethylpiperidine-3-carboxylate.
| Compound Name | (2-bromophenyl)methyl 3-ethylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 82824680 |
| Molecular Formula | C15H20BrNO2 |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | (2-bromophenyl)methyl 3-ethylpiperidine-3-carboxylate |
| SMILES | CCC1(C(=O)OCc2ccccc2Br)CCCNC1 |
| InChI | InChI=1S/C15H20BrNO2/c1-2-15(8-5-9-17-11-15)14(18)19-10-12-6-3-4-7-13(12)16/h3-4,6-7,17H,2,5,8-11H2,1H3 |
| InChIKey | SIZXWXYKFPLOLX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |