C11H11BrN2OS2 — CID 82833919
3-bromo-4-[(2-methyl-1,3-thiazol-4-yl)methylsulfinyl]aniline (PubChem CID 82833919) has the molecular formula C11H11BrN2OS2 and a molecular weight of 331.26 g/mol. Its IUPAC name is 3-bromo-4-[(2-methyl-1,3-thiazol-4-yl)methylsulfinyl]aniline.
| Compound Name | 3-bromo-4-[(2-methyl-1,3-thiazol-4-yl)methylsulfinyl]aniline |
|---|---|
| PubChem CID | 82833919 |
| Molecular Formula | C11H11BrN2OS2 |
| Molecular Weight | 331.26 g/mol |
| Exact Mass | 329.95 |
| IUPAC Name | 3-bromo-4-[(2-methyl-1,3-thiazol-4-yl)methylsulfinyl]aniline |
| SMILES | Cc1nc(CS(=O)c2ccc(N)cc2Br)cs1 |
| InChI | InChI=1S/C11H11BrN2OS2/c1-7-14-9(5-16-7)6-17(15)11-3-2-8(13)4-10(11)12/h2-5H,6,13H2,1H3 |
| InChIKey | NFKZCHWORNWSHG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.26 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|