About N-(2,2-dicyclopropylethyl)-1-(oxolan-2-yl)ethane-1,2-diamine
N-(2,2-dicyclopropylethyl)-1-(oxolan-2-yl)ethane-1,2-diamine (PubChem CID 82835521) has the molecular formula C14H26N2O
and a molecular weight of 238.37 g/mol. Its IUPAC name is N-(2,2-dicyclopropylethyl)-1-(oxolan-2-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N-(2,2-dicyclopropylethyl)-1-(oxolan-2-yl)ethane-1,2-diamine |
| PubChem CID | 82835521 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | N-(2,2-dicyclopropylethyl)-1-(oxolan-2-yl)ethane-1,2-diamine |
| SMILES | NCC(NCC(C1CC1)C1CC1)C1CCCO1 |
| InChI | InChI=1S/C14H26N2O/c15-8-13(14-2-1-7-17-14)16-9-12(10-3-4-10)11-5-6-11/h10-14,16H,1-9,15H2 |
| InChIKey | WXNOXBPBXRLQAO-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2,2-dicyclopropylethyl)-1-(oxolan-2-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-dicyclopropylethyl)-1-(oxolan-2-yl)ethane-1,2-diamine?
The IUPAC name of N-(2,2-dicyclopropylethyl)-1-(oxolan-2-yl)ethane-1,2-diamine (CID 82835521) is N-(2,2-dicyclopropylethyl)-1-(oxolan-2-yl)ethane-1,2-diamine.
What is the SMILES notation for N-(2,2-dicyclopropylethyl)-1-(oxolan-2-yl)ethane-1,2-diamine?
The canonical SMILES for N-(2,2-dicyclopropylethyl)-1-(oxolan-2-yl)ethane-1,2-diamine is NCC(NCC(C1CC1)C1CC1)C1CCCO1.
What is the InChIKey of N-(2,2-dicyclopropylethyl)-1-(oxolan-2-yl)ethane-1,2-diamine?
The InChIKey is WXNOXBPBXRLQAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O/c15-8-13(14-2-1-7-17-14)16-9-12(10-3-4-10)11-5-6-11/h10-14,16H,1-9,15H2.
What are the key properties of N-(2,2-dicyclopropylethyl)-1-(oxolan-2-yl)ethane-1,2-diamine?
N-(2,2-dicyclopropylethyl)-1-(oxolan-2-yl)ethane-1,2-diamine has a molecular weight of 238.37 g/mol, XLogP of 1.52, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-dicyclopropylethyl)-1-(oxolan-2-yl)ethane-1,2-diamine is sourced from PubChem (CID 82835521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).